CAS 886363-83-3
:1-[2-amino-1-(2-chlorophenyl)ethyl]pyrrolidine-3-carboxylic acid
Description:
1-[2-amino-1-(2-chlorophenyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886363-83-3, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a 2-chlorophenyl group attached to a carbon chain that connects to the pyrrolidine, contributing to its potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit properties typical of amino acids, such as being polar and capable of forming hydrogen bonds. Its amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry and drug development. The specific arrangement of its functional groups may influence its solubility, stability, and reactivity, which are critical for its application in pharmaceuticals or as a research chemical. Overall, this compound's structural features suggest it may have significant implications in various chemical and biological contexts.
Formula:C13H17ClN2O2
InChI:InChI=1/C13H17ClN2O2/c14-11-4-2-1-3-10(11)12(7-15)16-6-5-9(8-16)13(17)18/h1-4,9,12H,5-8,15H2,(H,17,18)
SMILES:c1ccc(c(c1)C(CN)N1CCC(C1)C(=O)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[2-Amino-1-(2-chloro-phenyl)-ethyl]-pyrrolidine-3-carboxylic acid
CAS:Formula:C13H17ClN2O2Molecular weight:268.7393
