CymitQuimica logo

CAS 886363-90-2

:

1-[2-Amino-1-(3-bromophenyl)ethyl]-3-pyrrolidinecarboxylic acid

Description:
1-[2-Amino-1-(3-bromophenyl)ethyl]-3-pyrrolidinecarboxylic acid, with the CAS number 886363-90-2, is a chemical compound characterized by its complex structure that includes an amino group, a bromophenyl moiety, and a pyrrolidine ring. This compound typically exhibits properties associated with amino acids and can participate in various biochemical interactions due to the presence of both amine and carboxylic acid functional groups. The bromine atom in the phenyl ring may influence its reactivity and solubility, potentially enhancing its biological activity. As a pyrrolidine derivative, it may also exhibit unique conformational characteristics that affect its pharmacological properties. The compound's potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific interactions would be necessary to fully understand its behavior in biological systems and its potential therapeutic uses.
Formula:C13H17BrN2O2
InChI:InChI=1S/C13H17BrN2O2/c14-11-3-1-2-9(6-11)12(7-15)16-5-4-10(8-16)13(17)18/h1-3,6,10,12H,4-5,7-8,15H2,(H,17,18)
InChI key:InChIKey=CGOPLTJIKFGKLC-UHFFFAOYSA-N
SMILES:C(CN)(N1CC(C(O)=O)CC1)C2=CC(Br)=CC=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-(3-bromophenyl)ethyl]-
  • 1-[2-Amino-1-(3-bromophenyl)ethyl]-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.