CymitQuimica logo

CAS 886363-93-5

:

1-[2-amino-1-(3-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid

Description:
1-[2-amino-1-(3-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886363-93-5, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring, an amino group, and a carboxylic acid functional group. This compound features a 3-fluorophenyl substituent, which contributes to its potential biological activity and pharmacological properties. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The carboxylic acid group can act as a proton donor, influencing its reactivity and interaction with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. Overall, this compound represents a class of molecules that could have significant implications in drug design and development.
Formula:C13H17FN2O2
InChI:InChI=1/C13H17FN2O2/c14-11-3-1-2-9(6-11)12(7-15)16-5-4-10(8-16)13(17)18/h1-3,6,10,12H,4-5,7-8,15H2,(H,17,18)
SMILES:c1cc(cc(c1)F)C(CN)N1CCC(C1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.