CAS 886363-94-6

1-[2-amino-1-(m-tolyl)ethyl]pyrrolidine-3-carboxylic acid

Description:

1-[2-amino-1-(m-tolyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886363-94-6, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a chiral center, contributing to its potential biological activity. The presence of the m-tolyl group suggests hydrophobic characteristics, which may influence its interaction with biological membranes and receptors. The carboxylic acid functional group provides acidic properties, allowing for potential interactions in biochemical pathways. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, the structural features of 1-[2-amino-1-(m-tolyl)ethyl]pyrrolidine-3-carboxylic acid suggest it could be of interest in research related to drug design and synthesis.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1/C14H20N2O2/c1-10-3-2-4-11(7-10)13(8-15)16-6-5-12(9-16)14(17)18/h2-4,7,12-13H,5-6,8-9,15H2,1H3,(H,17,18)

SMILES: Cc1cccc(c1)C(CN)N1CCC(C1)C(=O)O

1-(2-Amino-1-m-tolyl-ethyl)-pyrrolidine-3-carboxylic acid

CAS: 886363-94-6

Formula: C₁₄H₂₀N₂O₂

Molecular weight: 248.3208

Ref: IN-DA004A1Z