CymitQuimica logo

CAS 886363-95-7

:

1-[2-Amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinecarboxylic acid

Description:
1-[2-Amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinecarboxylic acid, with the CAS number 886363-95-7, is a chemical compound characterized by its complex structure, which includes an amino acid backbone and a pyrrolidine ring. This compound features multiple functional groups, including amino and carboxylic acid groups, which contribute to its potential biological activity. It is likely to exhibit properties typical of amino acids, such as being polar and capable of forming hydrogen bonds, which may influence its solubility in water and interaction with biological systems. The presence of the 3-aminophenyl group suggests potential for interactions with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's stereochemistry may play a crucial role in its biological activity, as is common with many amino acid derivatives. Overall, this compound's unique structure positions it as a candidate for further research in drug development and therapeutic applications.
Formula:C13H19N3O2
InChI:InChI=1S/C13H19N3O2/c14-7-12(9-2-1-3-11(15)6-9)16-5-4-10(8-16)13(17)18/h1-3,6,10,12H,4-5,7-8,14-15H2,(H,17,18)
InChI key:InChIKey=KAQMHGATDBSCMN-UHFFFAOYSA-N
SMILES:C(CN)(N1CC(C(O)=O)CC1)C2=CC(N)=CC=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-(3-aminophenyl)ethyl]-
  • 1-[2-Amino-1-(3-aminophenyl)ethyl]-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.