CymitQuimica logo

CAS 886363-96-8

:

1-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-3-carboxylic acid

Description:
1-[2-amino-1-(3,4-dimethoxyphenyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886363-96-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a 3,4-dimethoxyphenyl group, contributing to its potential biological activity and interaction with various receptors. The presence of the amino group and carboxylic acid functional group indicates that it may exhibit properties typical of amino acids, such as being polar and capable of forming hydrogen bonds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's solubility, stability, and reactivity would depend on the specific conditions, including pH and solvent used. Overall, this substance represents a class of compounds that may have significant implications in drug design and therapeutic applications, warranting further investigation into its pharmacological properties and mechanisms of action.
Formula:C15H22N2O4
InChI:InChI=1/C15H22N2O4/c1-20-13-4-3-10(7-14(13)21-2)12(8-16)17-6-5-11(9-17)15(18)19/h3-4,7,11-12H,5-6,8-9,16H2,1-2H3,(H,18,19)
SMILES:COc1ccc(cc1OC)C(CN)N1CCC(C1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.