CymitQuimica logo

CAS 886363-97-9

:

1-[2-Amino-1-[4-(phenylmethoxy)phenyl]ethyl]-3-pyrrolidinecarboxylic acid

Description:
1-[2-Amino-1-[4-(phenylmethoxy)phenyl]ethyl]-3-pyrrolidinecarboxylic acid, with the CAS number 886363-97-9, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a phenylmethoxy group, contributing to its potential lipophilicity and ability to interact with various biological targets. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the carboxylic acid functional group can engage in acid-base chemistry, making it relevant in various biochemical contexts. The compound's structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its unique combination of functional groups may also allow for diverse synthetic modifications, enhancing its utility in research and drug development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in chemical and pharmaceutical studies.
Formula:C20H24N2O3
InChI:InChI=1S/C20H24N2O3/c21-12-19(22-11-10-17(13-22)20(23)24)16-6-8-18(9-7-16)25-14-15-4-2-1-3-5-15/h1-9,17,19H,10-14,21H2,(H,23,24)
InChI key:InChIKey=RLESGJVQEIMGDD-UHFFFAOYSA-N
SMILES:C(CN)(N1CC(C(O)=O)CC1)C2=CC=C(OCC3=CC=CC=C3)C=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-[4-(phenylmethoxy)phenyl]ethyl]-
  • 1-[2-Amino-1-[4-(phenylmethoxy)phenyl]ethyl]-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.