CymitQuimica logo

CAS 886363-99-1

:

1-[2-amino-1-(4-bromophenyl)ethyl]pyrrolidine-3-carboxylic acid

Description:
1-[2-amino-1-(4-bromophenyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886363-99-1, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a bromophenyl group, which contributes to its unique properties and potential biological activity. The presence of the amino group and the carboxylic acid functional group suggests that it may exhibit both basic and acidic characteristics, making it soluble in polar solvents. Its structural features indicate potential interactions with biological targets, which could be of interest in medicinal chemistry and drug development. The compound may also exhibit chirality due to the presence of stereogenic centers, influencing its pharmacological profile. Overall, this substance is of interest for research in various fields, including organic synthesis and pharmaceutical applications, particularly in the development of compounds with specific biological activities.
Formula:C13H17BrN2O2
InChI:InChI=1/C13H17BrN2O2/c14-11-3-1-9(2-4-11)12(7-15)16-6-5-10(8-16)13(17)18/h1-4,10,12H,5-8,15H2,(H,17,18)
SMILES:c1cc(ccc1C(CN)N1CCC(C1)C(=O)O)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.