CAS 886364-00-7

1-[2-Amino-1-(4-chlorophenyl)ethyl]-3-pyrrolidinecarboxylic acid

Description:

1-[2-Amino-1-(4-chlorophenyl)ethyl]-3-pyrrolidinecarboxylic acid, with the CAS number 886364-00-7, is a chemical compound characterized by its unique structure that includes an amino group, a pyrrolidine ring, and a carboxylic acid functional group. This compound is typically classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid group. The 4-chlorophenyl substituent contributes to its potential biological activity, possibly influencing its interaction with various biological targets. The presence of the pyrrolidine ring may also impart specific conformational properties that affect its reactivity and solubility. Such compounds are often studied for their pharmacological properties, including potential roles in neurotransmission or as therapeutic agents. The stability, solubility, and reactivity of this compound can vary based on environmental conditions such as pH and temperature, making it important for researchers to consider these factors in experimental designs.

Formula: C₁₃H₁₇ClN₂O₂

InChI: InChI=1S/C13H17ClN2O2/c14-11-3-1-9(2-4-11)12(7-15)16-6-5-10(8-16)13(17)18/h1-4,10,12H,5-8,15H2,(H,17,18)

InChI key: InChIKey=XLMNZJVXHODAOE-UHFFFAOYSA-N

SMILES: C(CN)(N1CC(C(O)=O)CC1)C2=CC=C(Cl)C=C2

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-(4-chlorophenyl)ethyl]-
• 1-[2-Amino-1-(4-chlorophenyl)ethyl]-3-pyrrolidinecarboxylic acid

1-[2-Amino-1-(4-chlorophenyl)ethyl]pyrrolidine-3-carboxylic acid

CAS: 886364-00-7

Formula: C₁₃H₁₇ClN₂O₂

Molecular weight: 268.7393

Ref: IN-DA004AOT