CymitQuimica logo

CAS 886364-02-9

:

1-[2-amino-1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid

Description:
1-[2-amino-1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886364-02-9, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring, an amino group, and a carboxylic acid functional group. This compound features a 4-fluorophenyl substituent, which contributes to its potential biological activity. The presence of the amino and carboxylic acid groups suggests that it may exhibit properties typical of amino acids, such as being polar and capable of forming hydrogen bonds. The fluorine atom in the phenyl ring can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature, making it a subject of interest for further research in various chemical and biological applications.
Formula:C13H17FN2O2
InChI:InChI=1/C13H17FN2O2/c14-11-3-1-9(2-4-11)12(7-15)16-6-5-10(8-16)13(17)18/h1-4,10,12H,5-8,15H2,(H,17,18)
SMILES:c1cc(ccc1C(CN)N1CCC(C1)C(=O)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.