CymitQuimica logo

CAS 886364-05-2

:

1-[2-amino-1-(p-tolyl)ethyl]pyrrolidine-3-carboxylic acid

Description:
1-[2-amino-1-(p-tolyl)ethyl]pyrrolidine-3-carboxylic acid, with the CAS number 886364-05-2, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a p-tolyl group, which contributes to its hydrophobic characteristics, and an amino group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of a carboxylic acid functional group indicates that it can act as an acid, potentially participating in various chemical reactions, including esterification and amidation. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's stereochemistry may also play a crucial role in its biological activity, influencing how it interacts with biological receptors or enzymes. Overall, this compound exemplifies the complexity and versatility of amino acid derivatives in organic chemistry and drug design.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-10-2-4-11(5-3-10)13(8-15)16-7-6-12(9-16)14(17)18/h2-5,12-13H,6-9,15H2,1H3,(H,17,18)
SMILES:Cc1ccc(cc1)C(CN)N1CCC(C1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.