
CAS 886364-07-4
:1-[2-Amino-1-(4-methoxyphenyl)ethyl]-3-pyrrolidinecarboxylic acid
Description:
1-[2-Amino-1-(4-methoxyphenyl)ethyl]-3-pyrrolidinecarboxylic acid, identified by its CAS number 886364-07-4, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a 4-methoxyphenyl group, contributing to its aromatic properties and potential interactions in biological systems. The presence of both an amino group and a carboxylic acid group indicates that it can participate in various chemical reactions, including peptide bond formation and acid-base interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the structural similarities to neurotransmitters. Additionally, the methoxy group may enhance lipophilicity, influencing its bioavailability and pharmacokinetics. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and biochemical applications.
Formula:C14H20N2O3
InChI:InChI=1S/C14H20N2O3/c1-19-12-4-2-10(3-5-12)13(8-15)16-7-6-11(9-16)14(17)18/h2-5,11,13H,6-9,15H2,1H3,(H,17,18)
InChI key:InChIKey=RWYGQCFWBARQPA-UHFFFAOYSA-N
SMILES:C(CN)(N1CC(C(O)=O)CC1)C2=CC=C(OC)C=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-(4-methoxyphenyl)ethyl]-
- 1-[2-Amino-1-(4-methoxyphenyl)ethyl]-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[2-Amino-1-(4-methoxyphenyl)ethyl]pyrrolidine -3-carboxylic acid
CAS:Formula:C14H20N2O3Molecular weight:264.3202
