CAS 886364-10-9

1-[2-Amino-1-[4-(trifluoromethyl)phenyl]ethyl]-3-pyrrolidinecarboxylic acid

Description:

1-[2-Amino-1-[4-(trifluoromethyl)phenyl]ethyl]-3-pyrrolidinecarboxylic acid, with the CAS number 886364-10-9, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an amino acid moiety. This compound features a trifluoromethyl group, which is known for its electron-withdrawing properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, making it soluble in polar solvents. Its carboxylic acid functional group can act as a proton donor, contributing to its acidity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the trifluoromethyl group can enhance metabolic stability and bioavailability. Overall, this compound's unique structural features may lead to diverse applications in drug design and development.

Formula: C₁₄H₁₇F₃N₂O₂

InChI: InChI=1S/C14H17F3N2O2/c15-14(16,17)11-3-1-9(2-4-11)12(7-18)19-6-5-10(8-19)13(20)21/h1-4,10,12H,5-8,18H2,(H,20,21)

InChI key: InChIKey=PKPMAWHLBJUYDN-UHFFFAOYSA-N

SMILES: C(CN)(N1CC(C(O)=O)CC1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-[2-amino-1-[4-(trifluoromethyl)phenyl]ethyl]-
• 1-[2-Amino-1-[4-(trifluoromethyl)phenyl]ethyl]-3-pyrrolidinecarboxylic acid