CAS 886364-12-1
:(2S)-2-amino-3-(4-aminophenyl)propan-1-ol
Description:
(2S)-2-amino-3-(4-aminophenyl)propan-1-ol, with the CAS number 886364-12-1, is an organic compound characterized by its amino alcohol structure. It features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the S configuration. The molecule contains both an amino group and a hydroxyl group, making it a potential candidate for various biological applications, including as a building block in pharmaceuticals. The presence of the 4-aminophenyl group suggests that it may exhibit interesting interactions with biological targets, potentially influencing its pharmacological properties. This compound is likely to be soluble in polar solvents due to the hydroxyl group, while the aromatic ring may contribute to hydrophobic interactions. Its structural features may allow it to participate in hydrogen bonding, which is significant for its reactivity and interaction with other molecules. Overall, (2S)-2-amino-3-(4-aminophenyl)propan-1-ol is a compound of interest in medicinal chemistry and biochemistry due to its functional groups and stereochemistry.
Formula:C9H14N2O
InChI:InChI=1/C9H14N2O/c10-8-3-1-7(2-4-8)5-9(11)6-12/h1-4,9,12H,5-6,10-11H2/t9-/m0/s1
SMILES:c1cc(ccc1C[C@@H](CO)N)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
