CAS 886364-14-3
:γ,3-Diaminobenzenepropanol
Description:
γ,3-Diaminobenzenepropanol, identified by its CAS number 886364-14-3, is an organic compound characterized by the presence of both amine and alcohol functional groups. This compound features a benzene ring substituted with two amino groups at the 3 and 4 positions, along with a propanol chain that contributes to its reactivity and solubility properties. The presence of the hydroxyl (-OH) group enhances its ability to participate in hydrogen bonding, making it soluble in polar solvents like water. The amino groups can act as nucleophiles, allowing for various chemical reactions, including acylation and alkylation. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural features suggest potential applications in the synthesis of polymers, dyes, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c10-8-3-1-2-7(6-8)9(11)4-5-12/h1-3,6,9,12H,4-5,10-11H2
InChI key:InChIKey=UPGSIHAGFMXTAR-UHFFFAOYSA-N
SMILES:C(CCO)(N)C1=CC(N)=CC=C1
Synonyms:- 3-Amino-3-(3-aminophenyl)propan-1-ol
- Benzenepropanol, γ,3-diamino-
- γ,3-Diaminobenzenepropanol
- 3-Amino-3-(3-aminophenyl)-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
