CymitQuimica logo

CAS 886364-15-4

:

γ,2-Diaminobenzenepropanol

Description:
γ,2-Diaminobenzenepropanol, identified by its CAS number 886364-15-4, is an organic compound characterized by the presence of both amine and alcohol functional groups. This compound features a benzene ring substituted with two amino groups (–NH2) and a propanol moiety, which contributes to its unique reactivity and potential applications. The presence of the amino groups allows for hydrogen bonding and can enhance solubility in polar solvents, while the alcohol group can participate in various chemical reactions, including esterification and ether formation. γ,2-Diaminobenzenepropanol may exhibit properties such as being a solid or liquid at room temperature, depending on its specific structural configuration and purity. Its potential applications could span across pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of polymers or as a building block for more complex molecules. However, detailed safety and handling information should be consulted, as compounds with amine functionalities can be sensitive to air and moisture, and may require specific storage conditions.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c10-8-4-2-1-3-7(8)9(11)5-6-12/h1-4,9,12H,5-6,10-11H2
InChI key:InChIKey=GFFPCBOESULXHQ-UHFFFAOYSA-N
SMILES:C(CCO)(N)C1=C(N)C=CC=C1
Synonyms:
  • Benzenepropanol, γ,2-diamino-
  • γ,2-Diaminobenzenepropanol
  • 3-Amino-3-(2-aminophenyl)propan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.