CAS 886364-38-1

6-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine

Description:

6-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structural features, including a bromine atom and a trifluoromethyl group attached to a pyridine ring. This compound belongs to the class of pyridine derivatives, which are known for their diverse biological activities and applications in pharmaceuticals. The presence of the bromine atom can enhance the compound's reactivity and influence its interaction with biological targets. The trifluoromethyl group is notable for imparting lipophilicity and can significantly affect the compound's pharmacokinetic properties. Additionally, the amine functional group contributes to the compound's potential as a ligand in various chemical reactions. Overall, 6-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine exhibits characteristics that make it of interest in medicinal chemistry and material science, particularly in the development of new therapeutic agents or as a building block in organic synthesis. Its specific properties, such as solubility and stability, would depend on the surrounding conditions and the presence of other functional groups in a given formulation.

Formula: C₇H₆BrF₃N₂

InChI: InChI=1S/C7H6BrF3N2/c8-5-2-1-4(3-13-5)6(12)7(9,10)11/h1-3,6H,12H2

InChI key: InChIKey=MVEFKSSMIMWNSQ-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(N)C=1C=CC(Br)=NC1

Synonyms:

• 3-Pyridinemethanamine, 6-bromo-α-(trifluoromethyl)-
• 6-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine
• 1-(6-Bromopyridin-3-yl)-2,2,2-trifluoroethan-1-amine