CymitQuimica logo

CAS 886364-51-8

:

Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate

Description:
Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate, with CAS number 886364-51-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an ester functional group. This compound is typically classified as an amino acid derivative due to the presence of an amino group and a carboxylic acid moiety in its structure. It exhibits properties such as solubility in organic solvents, which is common for esters and amides, and may have specific reactivity patterns due to the presence of the piperidine ring, which can participate in various chemical reactions. The presence of the dimethylethoxycarbonyl group suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's stereochemistry, influenced by the α-methyl group, may affect its biological activity and interactions with biological targets. Overall, this compound represents a unique structure with potential utility in medicinal chemistry and related fields.
Formula:C15H28N2O4
InChI:InChI=1S/C15H28N2O4/c1-11(13(18)20-5)10-17-8-6-12(7-9-17)16-14(19)21-15(2,3)4/h11-12H,6-10H2,1-5H3,(H,16,19)
InChI key:InChIKey=OWJJBYSOTYYATM-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CCN(CC(C(OC)=O)C)CC1
Synonyms:
  • 1-Piperidinepropanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, methyl ester
  • Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.