CymitQuimica logo

CAS 886364-54-1

:

Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate

Description:
Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate, with CAS number 886364-54-1, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and an ester functional group. This compound features a methyl ester moiety, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the 1,1-dimethylethoxycarbonyl group indicates steric hindrance, which may influence its reactivity and interactions with biological systems. The compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic components, making it suitable for applications in medicinal chemistry and drug design. Additionally, the piperidine ring can impart basic properties, allowing for potential interactions with biological targets. Overall, this compound's unique structural features suggest it may have specific applications in pharmaceutical research, particularly in the development of novel therapeutic agents.
Formula:C15H28N2O4
InChI:InChI=1S/C15H28N2O4/c1-11(13(18)20-5)9-17-8-6-7-12(10-17)16-14(19)21-15(2,3)4/h11-12H,6-10H2,1-5H3,(H,16,19)
InChI key:InChIKey=QDXPEJJDZLXRNQ-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CN(CC(C(OC)=O)C)CCC1
Synonyms:
  • Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-piperidinepropanoate
  • 1-Piperidinepropanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.