
CAS 886364-58-5
:Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-azetidinepropanoate
Description:
Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-azetidinepropanoate, with the CAS number 886364-58-5, is a chemical compound characterized by its complex structure, which includes an azetidine ring, an amino group, and an ester functional group. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it possesses both hydrophilic and hydrophobic characteristics, which can influence its solubility and reactivity in various chemical environments. The presence of the dimethylethoxycarbonyl group indicates potential for further functionalization, making it a versatile building block in synthetic chemistry. Additionally, the azetidine ring contributes to its unique steric and electronic properties, which can affect its biological activity and interactions with other molecules. Overall, this compound exemplifies the complexity often found in organic molecules used in advanced chemical applications.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-9(11(16)18-5)6-15-7-10(8-15)14-12(17)19-13(2,3)4/h9-10H,6-8H2,1-5H3,(H,14,17)
InChI key:InChIKey=HKMPOZNDOMNVBC-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1CN(CC(C(OC)=O)C)C1
Synonyms:- 1-Azetidinepropanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-, methyl ester
- Methyl 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-methyl-1-azetidinepropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-tert-Butoxycarbonylamino-azetidin-1-yl)-2-methyl-propionic acid methyl ester
CAS:Formula:C13H24N2O4Molecular weight:272.3407
