
CAS 886364-60-9
:6-Bromo-α-(trifluoromethyl)-2-pyridinemethanamine
Description:
6-Bromo-α-(trifluoromethyl)-2-pyridinemethanamine is a chemical compound characterized by its unique structural features, including a bromine atom and a trifluoromethyl group attached to a pyridine ring. This compound belongs to the class of pyridine derivatives, which are known for their diverse biological activities and applications in pharmaceuticals. The presence of the bromine atom enhances its reactivity, while the trifluoromethyl group contributes to its lipophilicity and potential for interacting with biological targets. The amine functional group in the structure suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity in various chemical environments. This compound is of interest in medicinal chemistry, particularly for its potential use in drug development, as modifications to the pyridine ring can lead to compounds with specific pharmacological properties. Overall, 6-Bromo-α-(trifluoromethyl)-2-pyridinemethanamine exemplifies the complexity and versatility of pyridine derivatives in chemical research.
Formula:C7H6BrF3N2
InChI:InChI=1S/C7H6BrF3N2/c8-5-3-1-2-4(13-5)6(12)7(9,10)11/h1-3,6H,12H2
InChI key:InChIKey=YCUATFYSPCIFSY-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C=1N=C(Br)C=CC1
Synonyms:- 2-Pyridinemethanamine, 6-bromo-α-(trifluoromethyl)-
- 6-Bromo-α-(trifluoromethyl)-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.