
CAS 886364-90-5
:5-Bromo-4-methyl-2-pyridinemethanamine
Description:
5-Bromo-4-methyl-2-pyridinemethanamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 4-position of the pyridine ring contributes to its unique chemical properties. This compound features an amine functional group (-NH2) attached to a methylene bridge (-CH2-) linked to the pyridine, enhancing its reactivity and potential for forming hydrogen bonds. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound is of interest in medicinal chemistry and may serve as a building block for the synthesis of various pharmaceuticals or agrochemicals. Its reactivity can be influenced by the electron-withdrawing nature of the bromine atom and the electron-donating properties of the methyl group, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-5-2-6(3-9)10-4-7(5)8/h2,4H,3,9H2,1H3
InChI key:InChIKey=MTLADBRRYAKZSX-UHFFFAOYSA-N
SMILES:C(N)C1=CC(C)=C(Br)C=N1
Synonyms:- 5-Bromo-4-methyl-2-pyridinemethanamine
- 2-Pyridinemethanamine, 5-bromo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
