CAS 886364-97-2
:tert-butyl 3-(4-pyridylmethylamino)piperidine-1-carboxylate
Description:
Tert-butyl 3-(4-pyridylmethylamino)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a tert-butyl ester group, and a pyridylmethylamino substituent. This compound typically exhibits properties associated with both amines and carboxylic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The piperidine ring contributes to its cyclic structure, which can influence its conformational flexibility and biological activity. The pyridyl group may enhance its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the tert-butyl group can provide steric hindrance, potentially affecting the compound's pharmacokinetics and binding affinity. Overall, this compound's unique combination of functional groups suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C16H25N3O2
InChI:InChI=1/C16H25N3O2/c1-16(2,3)21-15(20)19-10-4-5-14(12-19)18-11-13-6-8-17-9-7-13/h6-9,14,18H,4-5,10-12H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCCC(C1)NCc1ccncc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
