CymitQuimica logo

CAS 886365-02-2

:

5-Bromo-4-methylpyridine-2-carboxylicacid

Description:
5-Bromo-4-methylpyridine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom, a methyl group, and a carboxylic acid functional group. The bromine substitution typically enhances the compound's reactivity and can influence its biological activity. The methyl group contributes to the compound's hydrophobic characteristics, while the carboxylic acid group imparts acidity and polar properties, making it soluble in polar solvents. This compound is often utilized in organic synthesis and medicinal chemistry, serving as an intermediate in the production of various pharmaceuticals and agrochemicals. Its unique structure allows for potential interactions in biological systems, making it a subject of interest in drug development. Additionally, the presence of the bromine atom can facilitate further functionalization reactions, expanding its utility in synthetic applications. Overall, 5-Bromo-4-methylpyridine-2-carboxylic acid is a versatile compound with significant implications in both research and industrial contexts.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c1-4-2-6(7(10)11)9-3-5(4)8/h2-3H,1H3,(H,10,11)
InChI key:RMSVDYVOLGRLNJ-UHFFFAOYSA-N
SMILES:CC1=CC(=NC=C1Br)C(=O)O
Synonyms:
  • 5-Bromo-4-methylpyridine-2-carboxylic acid
  • 2-Pyridinecarboxylic Acid, 5-Bromo-4-Methyl-
Found 5 products.