CAS 886365-09-9
:tert-butyl N-[1-[2-amino-1-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]carbamate
Description:
Tert-butyl N-[1-[2-amino-1-(3-fluorophenyl)ethyl]pyrrolidin-3-yl]carbamate, identified by its CAS number 886365-09-9, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a pyrrolidine ring, and an amino group attached to a phenyl moiety with a fluorine substituent. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the amino and carbamate functional groups. Its molecular structure suggests it may have biological activity, potentially acting as a pharmacological agent or a building block in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in drug design. Additionally, the compound's stereochemistry and functional groups may influence its reactivity and interactions with biological targets, which are critical for its application in pharmaceutical research.
Formula:C17H26FN3O2
InChI:InChI=1/C17H26FN3O2/c1-17(2,3)23-16(22)20-14-7-8-21(11-14)15(10-19)12-5-4-6-13(18)9-12/h4-6,9,14-15H,7-8,10-11,19H2,1-3H3,(H,20,22)
SMILES:CC(C)(C)OC(=NC1CCN(C1)C(CN)c1cccc(c1)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.