CAS 886365-21-5

Carbamic acid, [1-[2-amino-1-(4-bromophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

Description:

Carbamic acid, [1-[2-amino-1-(4-bromophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester, identified by CAS number 886365-21-5, is a chemical compound characterized by its complex structure, which includes a carbamic acid moiety and a pyrrolidine ring. This compound features a 4-bromophenyl group and an aminoethyl substituent, contributing to its potential biological activity. It is likely to exhibit properties typical of carbamates, such as being a potential inhibitor of certain enzymes or receptors due to the presence of the amino and pyrrolidine functionalities. The presence of the bromine atom may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the tert-butyl ester group suggests that the compound may have improved stability and solubility compared to its free acid form. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and pharmacological research, particularly in the development of therapeutic agents.

Formula: C₁₇H₂₆BrN₃O₂

InChI: InChI=1S/C17H26BrN3O2/c1-17(2,3)23-16(22)20-14-8-9-21(11-14)15(10-19)12-4-6-13(18)7-5-12/h4-7,14-15H,8-11,19H2,1-3H3,(H,20,22)

InChI key: InChIKey=OYHSTDNSJRIFFV-UHFFFAOYSA-N

SMILES: C(CN)(N1CC(NC(OC(C)(C)C)=O)CC1)C2=CC=C(Br)C=C2

Synonyms:

• Carbamic acid, [1-[2-amino-1-(4-bromophenyl)ethyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

(1-[2-amino-1-(4-bromo-phenyl)-ethyl]-pyrrolidin-3-yl)-carbamic acid tert-butyl ester

CAS: 886365-21-5

Formula: C₁₇H₂₆BrN₃O₂

Molecular weight: 384.3112

Ref: IN-DA008AIV

3-N-Boc-Amino-1-[2-amino-1-(4-bromo-phenyl)-ethyl]-pyrrolidine

CAS: 886365-21-5

Formula: C₁₇H₂₆BrN₃O₂

Purity: 97.0%

Molecular weight: 384.318

Ref: 10-F041366