CAS 886365-30-6
:1-Cyclopropyl-3-piperidinone
Description:
1-Cyclopropyl-3-piperidinone is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropyl group attached to a piperidinone moiety. This compound typically exhibits a molecular formula that reflects its cyclic and heterocyclic nature, contributing to its potential reactivity and biological activity. The presence of the piperidinone ring suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, due to the electron-rich nitrogen atom. Additionally, the cyclopropyl group can impart strain, influencing the compound's stability and reactivity. 1-Cyclopropyl-3-piperidinone may be of interest in medicinal chemistry for its potential pharmacological properties, as piperidine derivatives are often explored for their roles in drug development. Its physical properties, such as solubility and boiling point, would depend on the specific interactions of its functional groups. Overall, this compound represents a fascinating area of study within organic chemistry and drug design, with implications for various applications in pharmaceuticals and materials science.
Formula:C8H13NO
InChI:InChI=1S/C8H13NO/c10-8-2-1-5-9(6-8)7-3-4-7/h7H,1-6H2
InChI key:InChIKey=PBAZGNIGXUXWPD-UHFFFAOYSA-N
SMILES:O=C1CN(CCC1)C2CC2
Synonyms:- 1-Cyclopropyl-3-piperidinone
- 3-Piperidinone, 1-Cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
