CAS 886365-31-7

5-Bromo-2-chloroisonicotinic acid

Description:

5-Bromo-2-chloroisonicotinic acid is a heterocyclic organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both bromine and chlorine atoms, as well as a carboxylic acid functional group. This compound is characterized by its moderate solubility in polar solvents, which is typical for carboxylic acids, and it may exhibit varying solubility in non-polar solvents due to the presence of halogen substituents. The presence of both bromine and chlorine atoms can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for potential interactions with biological targets, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks.

Formula: C₆H₃BrClNO₂

InChI: InChI=1/C6H3BrClNO2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2H,(H,10,11)

SMILES: c1c(c(cnc1Cl)Br)C(=O)O

Synonyms:

• 5-Bromo-2-chloropyridine-4-carboxylic acid

5-Bromo-2-chloroisonicotinic acid

CAS: 886365-31-7

Formula: C₆H₃BrClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.4505

Ref: IN-DA004A1K

5-Bromo-2-chloroisonicotinic acid

CAS: 886365-31-7

5-Bromo-2-chloroisonicotinic acid

Formula: C₆H₃BrClNO₂

Purity: 98%

Color and Shape: beige solid

Molecular weight: 236.45g/mol

Ref: 54-OR3702

5-Bromo-2-chloro-isonicotinic acid

CAS: 886365-31-7

Formula: C₆H₃BrClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 236.45

Ref: 10-F033264