CAS 886365-39-5
:1-Cycloheptyl-3-piperidinone
Description:
1-Cycloheptyl-3-piperidinone is a chemical compound characterized by its unique structure, which includes a piperidinone ring and a cycloheptyl substituent. This compound features a piperidine ring, a six-membered nitrogen-containing heterocycle, with a ketone functional group at the third position, contributing to its reactivity and potential biological activity. The cycloheptyl group, a seven-membered carbon ring, adds to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like 1-Cycloheptyl-3-piperidinone may exhibit properties such as moderate to high lipophilicity, which can affect their pharmacokinetics and bioavailability. The presence of the piperidinone moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's structural features may allow for diverse synthetic modifications, making it a valuable intermediate in organic synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H21NO
InChI:InChI=1/C12H21NO/c14-12-8-5-9-13(10-12)11-6-3-1-2-4-7-11/h11H,1-10H2
InChI key:InChIKey=KDFFVKCYFNUAKL-UHFFFAOYSA-N
SMILES:O=C1CN(CCC1)C2CCCCCC2
Synonyms:- 1-Cycloheptyl-3-piperidinone
- 3-Piperidinone, 1-Cycloheptyl-
- 1-CYCLOHEPTYL-PIPERIDIN-3-ONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
