CymitQuimica logo

CAS 886365-40-8

:

5-Amino-3-methyl-2-pyridinecarboxylic acid

Description:
5-Amino-3-methyl-2-pyridinecarboxylic acid, also known as a derivative of pyridine, is an organic compound characterized by the presence of an amino group and a carboxylic acid functional group attached to a pyridine ring. This compound typically exhibits properties such as being a solid at room temperature, with a polar nature due to the functional groups, which can influence its solubility in water and organic solvents. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential as a ligand in coordination chemistry. The methyl group contributes to the compound's hydrophobic character, affecting its overall polarity. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for various synthetic modifications, which can lead to derivatives with altered properties. The CAS number 886365-40-8 uniquely identifies this compound in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and material science.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c1-4-2-5(8)3-9-6(4)7(10)11/h2-3H,8H2,1H3,(H,10,11)
InChI key:InChIKey=OXHFWJQCRORCBM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(N)C=N1
Synonyms:
  • 5-Amino-3-methyl-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 5-amino-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.