
CAS 886365-49-7
:Methyl 5-chloro-3-methyl-2-pyridinecarboxylate
Description:
Methyl 5-chloro-3-methyl-2-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl ester functional group, indicating that it is an ester derived from a carboxylic acid. The presence of chlorine and additional methyl groups on the pyridine ring contributes to its unique reactivity and potential applications in organic synthesis. Typically, compounds like this may exhibit moderate to high polarity due to the electronegative chlorine atom and the ester group, influencing their solubility in various solvents. The compound may also participate in nucleophilic substitution reactions, making it useful in the synthesis of more complex molecules. Additionally, its structural characteristics suggest potential biological activity, which could be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-5-3-6(9)4-10-7(5)8(11)12-2/h3-4H,1-2H3
InChI key:InChIKey=YZMKWTNQXIBEAO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C)C=C(Cl)C=N1
Synonyms:- Methyl 5-chloro-3-methyl-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 5-chloro-3-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
