CAS 886365-57-7

1-[(Phenylmethoxy)carbonyl]-3-piperidinebutanoic acid

Description:

1-[(Phenylmethoxy)carbonyl]-3-piperidinebutanoic acid, identified by its CAS number 886365-57-7, is a chemical compound characterized by its unique structure that includes a piperidine ring and a butanoic acid moiety. This compound features a phenylmethoxycarbonyl group, which contributes to its potential as a pharmaceutical intermediate or active ingredient. The presence of the piperidine ring suggests that it may exhibit properties typical of piperidine derivatives, such as potential neuroactive effects. The butanoic acid component indicates that it may possess acidic characteristics, influencing its solubility and reactivity in various environments. Additionally, the phenylmethoxy group can enhance lipophilicity, potentially affecting the compound's bioavailability and interaction with biological systems. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutics targeting neurological or metabolic pathways. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₇H₂₃NO₄

InChI: InChI=1S/C17H23NO4/c19-16(20)10-4-8-14-9-5-11-18(12-14)17(21)22-13-15-6-2-1-3-7-15/h1-3,6-7,14H,4-5,8-13H2,(H,19,20)

InChI key: InChIKey=CKTKTEQFRVSTPP-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(CCCC(O)=O)CCC2

Synonyms:

• 4-[1-[[(Phenylmethyl)oxy]carbonyl]-3-piperidinyl]butanoic acid
• 1-[(Phenylmethoxy)carbonyl]-3-piperidinebutanoic acid
• 3-Piperidinebutanoic acid, 1-[(phenylmethoxy)carbonyl]-

3-(3-carboxy-propyl)-piperidine-1-carboxylic acid benzyl ester

CAS: 886365-57-7

Formula: C₁₇H₂₃NO₄

Molecular weight: 305.3688

Ref: IN-DA0049LK