
CAS 886365-60-2
:5-Fluoro-3-methyl-2-pyridinemethanamine
Description:
5-Fluoro-3-methyl-2-pyridinemethanamine, with the CAS number 886365-60-2, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a fluorine atom and a methyl group attached to the pyridine ring, as well as an amine functional group, which contributes to its basicity and potential reactivity. The presence of the fluorine atom can influence the compound's electronic properties, making it of interest in medicinal chemistry and drug design, particularly for its potential biological activity. The amine group allows for hydrogen bonding, which can enhance solubility in polar solvents. Additionally, the compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 5-Fluoro-3-methyl-2-pyridinemethanamine is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C7H9FN2
InChI:InChI=1S/C7H9FN2/c1-5-2-6(8)4-10-7(5)3-9/h2,4H,3,9H2,1H3
InChI key:InChIKey=SBZUVOUQFLIBKX-UHFFFAOYSA-N
SMILES:C(N)C1=C(C)C=C(F)C=N1
Synonyms:- 2-Pyridinemethanamine, 5-fluoro-3-methyl-
- C-(5-Fluoro-3-methylpyridin-2-yl)methylamine
- (5-Fluoro-3-methylpyridin-2-yl)methanamine
- 5-Fluoro-3-methyl-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.