CAS 886365-64-6
:5-Bromo-2-propoxypyrimidine
Description:
5-Bromo-2-propoxypyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a propoxy group at the 2-position contributes to its unique reactivity and properties. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the development of pharmaceuticals. Its molecular structure allows for various substitution reactions, making it versatile in chemical applications. The bromine atom can participate in nucleophilic substitution reactions, while the propoxy group can influence solubility and reactivity. Additionally, 5-Bromo-2-propoxypyrimidine may exhibit biological activity, which can be explored in drug discovery contexts. As with many organic compounds, safety and handling precautions should be observed, as it may pose hazards typical of halogenated organic compounds.
Formula:C7H9BrN2O
InChI:InChI=1S/C7H9BrN2O/c1-2-3-11-7-9-4-6(8)5-10-7/h4-5H,2-3H2,1H3
InChI key:InChIKey=XRSHLCWIQIJJDH-UHFFFAOYSA-N
SMILES:O(CCC)C=1N=CC(Br)=CN1
Synonyms:- 5-Bromo-2-propoxypyrimidine
- Pyrimidine, 5-bromo-2-propoxy-
- 5-Bromo-2-(n-propoxy)pyrimidine
- 5-BROMO-2-PROPOXY-PYRIMIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
