CymitQuimica logo

CAS 886365-66-8

:

1,1-Dimethylethyl 4-[3-(6-chloro-3-pyridinyl)-2-methyl-3-oxopropyl]-1-piperazinecarboxylate

Description:
1,1-Dimethylethyl 4-[3-(6-chloro-3-pyridinyl)-2-methyl-3-oxopropyl]-1-piperazinecarboxylate, with CAS number 886365-66-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperazine ring and a pyridine moiety. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, making it of interest in pharmaceutical research. The presence of the chloro substituent on the pyridine ring may influence its reactivity and interaction with biological targets. Additionally, the dimethyl group contributes to steric hindrance, which can affect the compound's binding affinity and selectivity. The carboxylate functional group is likely to play a role in solubility and interaction with other molecules. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C18H26ClN3O3
InChI:InChI=1S/C18H26ClN3O3/c1-13(16(23)14-5-6-15(19)20-11-14)12-21-7-9-22(10-8-21)17(24)25-18(2,3)4/h5-6,11,13H,7-10,12H2,1-4H3
InChI key:InChIKey=FYLGAYNTYMYBBH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCN(CC(C(=O)C=2C=CC(Cl)=NC2)C)CC1
Synonyms:
  • 1,1-Dimethylethyl 4-[3-(6-chloro-3-pyridinyl)-2-methyl-3-oxopropyl]-1-piperazinecarboxylate
  • 1-Piperazinecarboxylic acid, 4-[3-(6-chloro-3-pyridinyl)-2-methyl-3-oxopropyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.