CAS 886365-71-5
:2-[(1,1-Dimethylethoxy)methyl]piperazine
Description:
2-[(1,1-Dimethylethoxy)methyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 1,1-dimethylethoxy group attached to a methylene bridge, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the piperazine moiety suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system due to its ability to interact with various neurotransmitter receptors. The compound may exhibit moderate to high solubility in polar solvents, influenced by the ether and amine functionalities. Additionally, it may possess basic properties due to the nitrogen atoms in the piperazine ring, allowing it to form salts with acids. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-9(2,3)12-7-8-6-10-4-5-11-8/h8,10-11H,4-7H2,1-3H3
InChI key:InChIKey=LSBXLZCVTCYWRQ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)C1CNCCN1
Synonyms:- Piperazine, 2-[(1,1-dimethylethoxy)methyl]-
- 2-[(1,1-Dimethylethoxy)methyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
