CymitQuimica logo

CAS 886365-97-5

:

5-Bromo-N-2-propen-1-yl-2-pyrimidinamine

Description:
5-Bromo-N-2-propen-1-yl-2-pyrimidinamine is a chemical compound characterized by its unique structure, which includes a bromine atom, a propenyl group, and a pyrimidinamine moiety. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. The presence of the bromine substituent enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The propenyl group contributes to its unsaturation, allowing for further functionalization. This compound may exhibit biological activity, potentially serving as a lead compound in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, making it important to consider these factors in practical applications. Overall, 5-Bromo-N-2-propen-1-yl-2-pyrimidinamine represents a versatile structure in organic synthesis and drug development.
Formula:C7H8BrN3
InChI:InChI=1S/C7H8BrN3/c1-2-3-9-7-10-4-6(8)5-11-7/h2,4-5H,1,3H2,(H,9,10,11)
InChI key:InChIKey=PBZYUUCQZODXKC-UHFFFAOYSA-N
SMILES:N(CC=C)C=1N=CC(Br)=CN1
Synonyms:
  • 2-Pyrimidinamine, 5-bromo-N-2-propenyl-
  • 2-Pyrimidinamine, 5-bromo-N-2-propen-1-yl-
  • 5-Bromo-N-2-propen-1-yl-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.