
CAS 886366-00-3
:1-(3-Methylphenyl)cyclopropanemethanamine
Description:
1-(3-Methylphenyl)cyclopropanemethanamine, identified by its CAS number 886366-00-3, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and an amine functional group. This compound features a 3-methylphenyl group, which contributes to its aromatic properties and potential interactions in biological systems. The presence of the cyclopropane moiety may impart strain and influence the compound's reactivity and stability. As an amine, it can participate in hydrogen bonding and may exhibit basicity, making it relevant in various chemical reactions and applications. The compound's specific characteristics, such as solubility, melting point, and boiling point, would depend on its molecular interactions and the surrounding environment. Due to its structural features, it may be of interest in medicinal chemistry and material science, although detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C11H15N
InChI:InChI=1S/C11H15N/c1-9-3-2-4-10(7-9)11(8-12)5-6-11/h2-4,7H,5-6,8,12H2,1H3
InChI key:InChIKey=CYGQQOPZCFJBKI-UHFFFAOYSA-N
SMILES:C(N)C1(CC1)C2=CC(C)=CC=C2
Synonyms:- 1-(3-Methylphenyl)cyclopropanemethanamine
- Cyclopropanemethanamine, 1-(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.