CAS 886366-02-5
:ethyl 2-(methylaminomethyl)-3-(p-tolyl)propanoate
Description:
Ethyl 2-(methylaminomethyl)-3-(p-tolyl)propanoate, with the CAS number 886366-02-5, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features a propanoate backbone, with a p-tolyl group, indicating the presence of a para-substituted methyl group on a phenyl ring, contributing to its aromatic characteristics. The methylaminomethyl substituent suggests the presence of a secondary amine, which can influence the compound's reactivity and potential biological activity. Ethyl esters generally exhibit moderate volatility and solubility in organic solvents, making them useful in various applications, including pharmaceuticals and agrochemicals. The presence of both hydrophobic (aromatic) and hydrophilic (ethyl ester) components in its structure may affect its interaction with biological systems, potentially impacting its pharmacokinetic properties. Overall, this compound's unique structure may confer specific properties that could be explored in medicinal chemistry or related fields.
Formula:C14H21NO2
InChI:InChI=1/C14H21NO2/c1-4-17-14(16)13(10-15-3)9-12-7-5-11(2)6-8-12/h5-8,13,15H,4,9-10H2,1-3H3
SMILES:CCOC(=O)C(Cc1ccc(C)cc1)CNC
Synonyms:- Ethyl 3-(methylamino)-2-(4-methylbenzyl)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
