CAS 886366-03-6
:1-(2-Nitrophenyl)cyclopropanemethanamine
Description:
1-(2-Nitrophenyl)cyclopropanemethanamine is an organic compound characterized by its cyclopropane structure fused with a nitrophenyl group. This compound features a cyclopropane ring, which is a three-membered carbon ring known for its unique strain and reactivity. The presence of the nitrophenyl group introduces both electron-withdrawing characteristics and potential for further chemical reactivity, particularly in electrophilic aromatic substitution reactions. The amine functional group contributes to its basicity and potential for forming hydrogen bonds, influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-(2-Nitrophenyl)cyclopropanemethanamine represents a complex structure with potential applications in various fields of chemistry and pharmacology.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c11-7-10(5-6-10)8-3-1-2-4-9(8)12(13)14/h1-4H,5-7,11H2
InChI key:InChIKey=YBIYOHNRGZELNN-UHFFFAOYSA-N
SMILES:C(N)C1(CC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- 1-(2-Nitrophenyl)cyclopropanemethanamine
- Cyclopropanemethanamine, 1-(2-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.