CAS 886366-12-7
:ethyl 2-[(3-bromophenyl)methyl]-3-methylamino-propanoate
Description:
Ethyl 2-[(3-bromophenyl)methyl]-3-methylamino-propanoate is an organic compound characterized by its ester functional group, which is typical of ethyl esters. The presence of a bromophenyl group indicates that it has a bromine atom attached to a phenyl ring, contributing to its potential reactivity and biological activity. The compound features a propanoate backbone, which includes a methylamino group, suggesting it may exhibit properties associated with amines, such as basicity and potential interactions with biological systems. The molecular structure implies that it could participate in various chemical reactions, including nucleophilic substitutions and ester hydrolysis. Additionally, the presence of the bromine atom may enhance its lipophilicity, affecting its solubility and permeability in biological membranes. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities or applications would require further investigation.
Formula:C13H18BrNO2
InChI:InChI=1/C13H18BrNO2/c1-3-17-13(16)11(9-15-2)7-10-5-4-6-12(14)8-10/h4-6,8,11,15H,3,7,9H2,1-2H3
Synonyms:- Ethyl 2-(3-bromobenzyl)-3-(methylamino)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
