CymitQuimica logo

CAS 886366-17-2

:

5-Bromo-N-cyclohexyl-2-pyrimidinamine

Description:
5-Bromo-N-cyclohexyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a bromine atom at the 5-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. The cyclohexyl group attached to the nitrogen atom enhances the compound's lipophilicity, which may influence its biological activity and pharmacokinetic properties. This compound is of interest in research, particularly in the development of pharmaceuticals, due to its potential as a kinase inhibitor or in other therapeutic areas. Its molecular structure allows for various interactions with biological targets, making it a candidate for further investigation in drug discovery. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C10H14BrN3
InChI:InChI=1S/C10H14BrN3/c11-8-6-12-10(13-7-8)14-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,12,13,14)
InChI key:InChIKey=QRGGKWPYPCIJAD-UHFFFAOYSA-N
SMILES:N(C=1N=CC(Br)=CN1)C2CCCCC2
Synonyms:
  • 2-Pyrimidinamine, 5-bromo-N-cyclohexyl-
  • 5-Bromo-N-cyclohexyl-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.