CAS 886366-26-3

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinebutanoic acid

Description:

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinebutanoic acid, commonly referred to as Fmoc-3-piperidinebutanoic acid, is a chemical compound used primarily in peptide synthesis as a protecting group for amino acids. The Fmoc group is known for its stability under basic conditions and can be easily removed under mild acidic conditions, making it advantageous in solid-phase peptide synthesis. The compound features a piperidine ring, which contributes to its basicity and potential for forming hydrogen bonds, enhancing its reactivity in coupling reactions. Additionally, the presence of the butanoic acid moiety provides a carboxylic acid functional group, which can participate in further chemical transformations. The fluorenylmethoxycarbonyl (Fmoc) group imparts significant steric hindrance, influencing the compound's solubility and reactivity. Overall, this compound is valued in synthetic organic chemistry for its role in facilitating the assembly of peptides and proteins, contributing to advancements in drug development and biochemistry research.

Formula: C₂₄H₂₇NO₄

InChI: InChI=1S/C24H27NO4/c26-23(27)13-5-7-17-8-6-14-25(15-17)24(28)29-16-22-20-11-3-1-9-18(20)19-10-2-4-12-21(19)22/h1-4,9-12,17,22H,5-8,13-16H2,(H,26,27)

InChI key: InChIKey=UIDAXORFQBOKLU-UHFFFAOYSA-N

SMILES: C(OC(=O)N1CC(CCCC(O)=O)CCC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 3-Piperidinebutanoic acid, 1-[(9H-fluoren-9-ylmethoxy)carbonyl]-
• 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-piperidinebutanoic acid

4-(1-FMOC-PIPERIDIN-3-YL)-BUTYRIC ACID

CAS: 886366-26-3

Formula: C₂₄H₂₇NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 393.4755

Ref: IN-DA008AFS

4-(1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidin-3-yl)butanoic acid

CAS: 886366-26-3

4-(1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidin-3-yl)butanoic acid

Purity: 97%

Molecular weight: 393.48g/mol

Ref: 54-OR1057745