
CAS 886366-28-5
:5-Bromo-N,N-bis(phenylmethyl)-2-pyrimidinamine
Description:
5-Bromo-N,N-bis(phenylmethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. The compound features two phenylmethyl groups attached to the nitrogen atoms, which can enhance its lipophilicity and influence its biological activity. This structure may allow for interactions with various biological targets, making it of interest in drug development. The compound's molecular properties, such as solubility, stability, and reactivity, can be influenced by the bromine substituent and the bulky phenylmethyl groups. Additionally, its CAS number, 886366-28-5, serves as a unique identifier for regulatory and safety information. Overall, 5-Bromo-N,N-bis(phenylmethyl)-2-pyrimidinamine presents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C18H16BrN3
InChI:InChI=1S/C18H16BrN3/c19-17-11-20-18(21-12-17)22(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-12H,13-14H2
InChI key:InChIKey=QRWDAIXMGNQNLW-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C=3N=CC(Br)=CN3
Synonyms:- 5-Bromo-N,N-bis(phenylmethyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 5-bromo-N,N-bis(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.