CAS 886366-32-1
:5-(1-amino-3-hydroxy-propyl)-2-methoxy-phenol
Description:
5-(1-Amino-3-hydroxy-propyl)-2-methoxy-phenol, identified by its CAS number 886366-32-1, is an organic compound characterized by its phenolic structure, which includes a methoxy group and an amino-alcohol side chain. This compound typically exhibits properties associated with phenols, such as being a weak acid due to the hydroxyl group, and it may participate in hydrogen bonding due to the presence of both the amino and hydroxyl groups. The methoxy group can influence its solubility and reactivity, often enhancing lipophilicity. The amino group suggests potential for biological activity, possibly acting as a neurotransmitter or in other biochemical pathways. Its structure may allow for various interactions with biological molecules, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique functional groups contribute to its potential applications in pharmaceuticals and biochemistry.
Formula:C10H15NO3
InChI:InChI=1/C10H15NO3/c1-14-10-3-2-7(6-9(10)13)8(11)4-5-12/h2-3,6,8,12-13H,4-5,11H2,1H3
SMILES:COc1ccc(cc1O)C(CCO)N
Synonyms:- 5-(1-Amino-3-hydroxypropyl)-2-methoxyphenol
- Benzenepropanol, γ-amino-3-hydroxy-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
