CymitQuimica logo

CAS 886366-38-7

:

Methyl 4-[(1,1-dimethylethoxy)carbonyl]-α-methyl-1-piperazinepropanoate

Description:
Methyl 4-[(1,1-dimethylethoxy)carbonyl]-α-methyl-1-piperazinepropanoate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a propanoate moiety, and an ester functional group. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the presence of functional groups. The piperazine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the dimethylethoxycarbonyl group suggests that it may have applications in synthetic chemistry, particularly in the development of prodrugs or intermediates. Additionally, the compound's molecular structure may influence its physical properties, such as melting point, boiling point, and polarity, which are critical for its behavior in various chemical environments. Overall, this compound represents a unique combination of structural features that may confer specific chemical and biological properties.
Formula:C14H26N2O4
InChI:InChI=1S/C14H26N2O4/c1-11(12(17)19-5)10-15-6-8-16(9-7-15)13(18)20-14(2,3)4/h11H,6-10H2,1-5H3
InChI key:InChIKey=BDEAVZQFIXHXIP-UHFFFAOYSA-N
SMILES:C(C(C(OC)=O)C)N1CCN(C(OC(C)(C)C)=O)CC1
Synonyms:
  • Methyl 4-[(1,1-dimethylethoxy)carbonyl]-α-methyl-1-piperazinepropanoate
  • tert-Butyl 4-(3-methoxy-2-methyl-3-oxopropyl)piperazine-1-carboxylate
  • 1-Piperazinepropanoic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.