CAS 886366-44-5

1-(3-Methylphenyl)cyclopropanemethanol

Description:

1-(3-Methylphenyl)cyclopropanemethanol, identified by its CAS number 886366-44-5, is an organic compound characterized by a cyclopropane ring attached to a phenyl group that has a methyl substituent at the para position. This compound features a hydroxyl (-OH) functional group, which classifies it as an alcohol. The presence of the cyclopropane structure contributes to its unique three-dimensional conformation, potentially influencing its reactivity and interactions with other molecules. The methyl group on the phenyl ring can affect the compound's electronic properties and steric hindrance, which may play a role in its biological activity or chemical reactivity. Generally, compounds like this may exhibit interesting properties such as solubility in organic solvents, potential for hydrogen bonding due to the hydroxyl group, and varying degrees of stability depending on the surrounding conditions. Its specific applications or biological significance would depend on further research and context within medicinal chemistry or materials science.

Formula: C₁₁H₁₄O

InChI: InChI=1S/C11H14O/c1-9-3-2-4-10(7-9)11(8-12)5-6-11/h2-4,7,12H,5-6,8H2,1H3

InChI key: InChIKey=ZOZAOVFPLXEHTC-UHFFFAOYSA-N

SMILES: C(O)C1(CC1)C2=CC(C)=CC=C2

Synonyms:

• Cyclopropanemethanol, 1-(3-methylphenyl)-
• [1-(3-Methylphenyl)cyclopropyl]methanol
• (1-m-Tolyl-cyclopropyl)-methanol
• 1-(3-Methylphenyl)cyclopropanemethanol