CymitQuimica logo

CAS 886366-46-7

:

methyl 2-[(4-bromophenyl)methyl]-3-(tert-butoxycarbonylamino)propanoate

Description:
Methyl 2-[(4-bromophenyl)methyl]-3-(tert-butoxycarbonylamino)propanoate, with the CAS number 886366-46-7, is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a bromophenyl moiety, and a tert-butoxycarbonyl (Boc) protecting group for the amino functionality. This compound typically appears as a solid or viscous liquid, depending on its purity and temperature. It is soluble in organic solvents such as dichloromethane and ethyl acetate, but may have limited solubility in water due to its hydrophobic components. The presence of the bromine atom enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The tert-butoxycarbonyl group serves as a protective group for amines, allowing for selective reactions without affecting the amino functionality. Overall, this compound is of interest in the development of pharmaceuticals and other chemical products, owing to its unique structural features and potential reactivity.
Formula:C16H22BrNO4
InChI:InChI=1/C16H22BrNO4/c1-16(2,3)22-15(20)18-10-12(14(19)21-4)9-11-5-7-13(17)8-6-11/h5-8,12H,9-10H2,1-4H3,(H,18,20)
InChI key:DMLNRZMFIHFUNG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCC(Cc1ccc(cc1)Br)C(=O)OC)O
Found 3 products.