
CAS 886366-49-0
:Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methylbenzenepropanoate
Description:
Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methylbenzenepropanoate, identified by its CAS number 886366-49-0, is a chemical compound characterized by its complex structure, which includes an ester functional group and an amine moiety. This compound features a methyl ester derived from a propanoic acid, with a substituted aromatic ring that enhances its chemical properties. The presence of the 1,1-dimethylethoxycarbonyl group suggests steric hindrance, which can influence its reactivity and solubility. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, making them potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the specific arrangement of functional groups can impart unique biological activities, which may be of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields.
Formula:C17H25NO4
InChI:InChI=1S/C17H25NO4/c1-12-6-8-13(9-7-12)10-14(15(19)21-5)11-18-16(20)22-17(2,3)4/h6-9,14H,10-11H2,1-5H3,(H,18,20)
InChI key:InChIKey=UKHNGZFSBULVPW-UHFFFAOYSA-N
SMILES:C(C(CNC(OC(C)(C)C)=O)C(OC)=O)C1=CC=C(C)C=C1
Synonyms:- Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methylbenzenepropanoate
- Benzenepropanoic acid, α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 3-((tert-butoxycarbonyl)amino)-2-(4-methylbenzyl)propanoate
CAS:Formula:C17H25NO4Molecular weight:307.3847
