CymitQuimica logo

CAS 886366-52-5

:

Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methoxybenzenepropanoate

Description:
Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methoxybenzenepropanoate, identified by its CAS number 886366-52-5, is a chemical compound characterized by its complex structure, which includes a methoxybenzene moiety and an amino acid derivative. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the methoxy group contributes to its potential for hydrogen bonding and influences its reactivity. Additionally, the dimethylethoxycarbonyl group provides steric hindrance, which can affect its interaction with biological systems, making it of interest in medicinal chemistry. The compound may also display specific functional properties, such as being a potential prodrug or having applications in drug delivery systems. Its synthesis and characterization would involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its purity and structural integrity. Overall, this compound's unique functional groups and structural features suggest potential utility in pharmaceutical applications.
Formula:C17H25NO5
InChI:InChI=1S/C17H25NO5/c1-17(2,3)23-16(20)18-11-13(15(19)22-5)10-12-6-8-14(21-4)9-7-12/h6-9,13H,10-11H2,1-5H3,(H,18,20)
InChI key:InChIKey=PPGQXIUFJSJUMP-UHFFFAOYSA-N
SMILES:C(C(CNC(OC(C)(C)C)=O)C(OC)=O)C1=CC=C(OC)C=C1
Synonyms:
  • Methyl α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methoxybenzenepropanoate
  • Benzenepropanoic acid, α-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-4-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.